C22H34O4 — CID 162969619
[(1R,2R,6R,7R,8R,13S)-9,13-dimethyl-3-methylidene-12-oxo-6-propan-2-yl-15-oxatricyclo[6.6.1.02,7]pentadecan-9-yl] acetate (PubChem CID 162969619) has the molecular formula C22H34O4 and a molecular weight of 362.51 g/mol. Its IUPAC name is [(1R,2R,6R,7R,8R,13S)-9,13-dimethyl-3-methylidene-12-oxo-6-propan-2-yl-15-oxatricyclo[6.6.1.02,7]pentadecan-9-yl] acetate.
| Compound Name | [(1R,2R,6R,7R,8R,13S)-9,13-dimethyl-3-methylidene-12-oxo-6-propan-2-yl-15-oxatricyclo[6.6.1.02,7]pentadecan-9-yl] acetate |
|---|---|
| PubChem CID | 162969619 |
| Molecular Formula | C22H34O4 |
| Molecular Weight | 362.51 g/mol |
| Exact Mass | 362.25 |
| IUPAC Name | [(1R,2R,6R,7R,8R,13S)-9,13-dimethyl-3-methylidene-12-oxo-6-propan-2-yl-15-oxatricyclo[6.6.1.02,7]pentadecan-9-yl] acetate |
| SMILES | C=C1CC[C@H](C(C)C)[C@@H]2[C@H]1[C@H]1C[C@H](C)C(=O)CCC(C)(OC(C)=O)[C@@H]2O1 |
| InChI | InChI=1S/C22H34O4/c1-12(2)16-8-7-13(3)19-18-11-14(4)17(24)9-10-22(6,26-15(5)23)21(25-18)20(16)19/h12,14,16,18-21H,3,7-11H2,1-2,4-6H3/t14-,16+,18+,19+,20+,21+,22?/m0/s1 |
| InChIKey | HYDCAKGOTMKJRP-JPBFMQJXSA-N |
| XLogP | 4.32 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.51 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|