C26H40O9 — CID 163113785
(5,14-diacetyloxy-9,10-dihydroxy-10,14-dimethyl-6-methylidene-3-propan-2-yl-15-oxatricyclo[6.6.1.02,7]pentadecan-11-yl) acetate (PubChem CID 163113785) has the molecular formula C26H40O9 and a molecular weight of 496.60 g/mol. Its IUPAC name is (5,14-diacetyloxy-9,10-dihydroxy-10,14-dimethyl-6-methylidene-3-propan-2-yl-15-oxatricyclo[6.6.1.02,7]pentadecan-11-yl) acetate.
| Compound Name | (5,14-diacetyloxy-9,10-dihydroxy-10,14-dimethyl-6-methylidene-3-propan-2-yl-15-oxatricyclo[6.6.1.02,7]pentadecan-11-yl) acetate |
|---|---|
| PubChem CID | 163113785 |
| Molecular Formula | C26H40O9 |
| Molecular Weight | 496.60 g/mol |
| Exact Mass | 496.27 |
| IUPAC Name | (5,14-diacetyloxy-9,10-dihydroxy-10,14-dimethyl-6-methylidene-3-propan-2-yl-15-oxatricyclo[6.6.1.02,7]pentadecan-11-yl) acetate |
| SMILES | C=C1C(OC(C)=O)CC(C(C)C)C2C1C1OC2C(C)(OC(C)=O)CCC(OC(C)=O)C(C)(O)C1O |
| InChI | InChI=1S/C26H40O9/c1-12(2)17-11-18(32-14(4)27)13(3)20-21(17)24-25(7,35-16(6)29)10-9-19(33-15(5)28)26(8,31)23(30)22(20)34-24/h12,17-24,30-31H,3,9-11H2,1-2,4-8H3 |
| InChIKey | TWFWOYCOQFVMCU-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 128.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.60 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|