C28H44O10 — CID 163111958
[(1S,2R,4S,6R,7R,8R,9R,12S,13R,14S)-4-acetyloxy-6-[(2R)-1-acetyloxypropan-2-yl]-12,13,14-trihydroxy-9,13-dimethyl-3-methylidene-15-oxatricyclo[6.6.1.02,7]pentadecan-9-yl] butanoate (PubChem CID 163111958) has the molecular formula C28H44O10 and a molecular weight of 540.65 g/mol. Its IUPAC name is [(1S,2R,4S,6R,7R,8R,9R,12S,13R,14S)-4-acetyloxy-6-[(2R)-1-acetyloxypropan-2-yl]-12,13,14-trihydroxy-9,13-dimethyl-3-methylidene-15-oxatricyclo[6.6.1.02,7]pentadecan-9-yl] butanoate.
| Compound Name | [(1S,2R,4S,6R,7R,8R,9R,12S,13R,14S)-4-acetyloxy-6-[(2R)-1-acetyloxypropan-2-yl]-12,13,14-trihydroxy-9,13-dimethyl-3-methylidene-15-oxatricyclo[6.6.1.02,7]pentadecan-9-yl] butanoate |
|---|---|
| PubChem CID | 163111958 |
| Molecular Formula | C28H44O10 |
| Molecular Weight | 540.65 g/mol |
| Exact Mass | 540.29 |
| IUPAC Name | [(1S,2R,4S,6R,7R,8R,9R,12S,13R,14S)-4-acetyloxy-6-[(2R)-1-acetyloxypropan-2-yl]-12,13,14-trihydroxy-9,13-dimethyl-3-methylidene-15-oxatricyclo[6.6.1.02,7]pentadecan-9-yl] butanoate |
| SMILES | C=C1[C@@H]2[C@@H]3O[C@H]([C@@H]2[C@@H]([C@@H](C)COC(C)=O)C[C@@H]1OC(C)=O)[C@](C)(OC(=O)CCC)CC[C@H](O)[C@@](C)(O)[C@H]3O |
| InChI | InChI=1S/C28H44O10/c1-8-9-21(32)38-27(6)11-10-20(31)28(7,34)25(33)24-22-15(3)19(36-17(5)30)12-18(23(22)26(27)37-24)14(2)13-35-16(4)29/h14,18-20,22-26,31,33-34H,3,8-13H2,1-2,4-7H3/t14-,18+,19-,20-,22-,23+,24-,25-,26+,27+,28+/m0/s1 |
| InChIKey | OMKJLZHQDDQHBS-BFYKZALZSA-N |
| XLogP | 2.06 |
| TPSA | 148.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.65 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|