C28H44O9 — CID 51032481
[(1R,2S,3S,4R,5S,6R,7R,8R,9R,12S)-4,5-diacetyloxy-3,12-dihydroxy-3,9-dimethyl-13-methylidene-6-propan-2-yl-15-oxatricyclo[6.6.1.02,7]pentadecan-9-yl] butanoate (PubChem CID 51032481) has the molecular formula C28H44O9 and a molecular weight of 524.65 g/mol. Its IUPAC name is [(1R,2S,3S,4R,5S,6R,7R,8R,9R,12S)-4,5-diacetyloxy-3,12-dihydroxy-3,9-dimethyl-13-methylidene-6-propan-2-yl-15-oxatricyclo[6.6.1.02,7]pentadecan-9-yl] butanoate.
| Compound Name | [(1R,2S,3S,4R,5S,6R,7R,8R,9R,12S)-4,5-diacetyloxy-3,12-dihydroxy-3,9-dimethyl-13-methylidene-6-propan-2-yl-15-oxatricyclo[6.6.1.02,7]pentadecan-9-yl] butanoate |
|---|---|
| PubChem CID | 51032481 |
| Molecular Formula | C28H44O9 |
| Molecular Weight | 524.65 g/mol |
| Exact Mass | 524.30 |
| IUPAC Name | [(1R,2S,3S,4R,5S,6R,7R,8R,9R,12S)-4,5-diacetyloxy-3,12-dihydroxy-3,9-dimethyl-13-methylidene-6-propan-2-yl-15-oxatricyclo[6.6.1.02,7]pentadecan-9-yl] butanoate |
| SMILES | C=C1C[C@H]2O[C@H]([C@@H]3[C@@H](C(C)C)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@](C)(O)[C@@H]32)[C@](C)(OC(=O)CCC)CC[C@@H]1O |
| InChI | InChI=1S/C28H44O9/c1-9-10-20(32)37-27(7)12-11-18(31)15(4)13-19-23-22(25(27)36-19)21(14(2)3)24(34-16(5)29)26(28(23,8)33)35-17(6)30/h14,18-19,21-26,31,33H,4,9-13H2,1-3,5-8H3/t18-,19+,21+,22+,23+,24-,25+,26+,27+,28-/m0/s1 |
| InChIKey | IXNMXULEWLXCOJ-YHTYPLSOSA-N |
| XLogP | 3.09 |
| TPSA | 128.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.65 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|