C28H42O7 — CID 162967461
[(1S,2R,4R,5S,6R,7R,8R,9R,12E)-4,5-diacetyloxy-9,13-dimethyl-3-methylidene-6-propan-2-yl-15-oxatricyclo[6.6.1.02,7]pentadec-12-en-9-yl] butanoate (PubChem CID 162967461) has the molecular formula C28H42O7 and a molecular weight of 490.64 g/mol. Its IUPAC name is [(1S,2R,4R,5S,6R,7R,8R,9R,12E)-4,5-diacetyloxy-9,13-dimethyl-3-methylidene-6-propan-2-yl-15-oxatricyclo[6.6.1.02,7]pentadec-12-en-9-yl] butanoate.
| Compound Name | [(1S,2R,4R,5S,6R,7R,8R,9R,12E)-4,5-diacetyloxy-9,13-dimethyl-3-methylidene-6-propan-2-yl-15-oxatricyclo[6.6.1.02,7]pentadec-12-en-9-yl] butanoate |
|---|---|
| PubChem CID | 162967461 |
| Molecular Formula | C28H42O7 |
| Molecular Weight | 490.64 g/mol |
| Exact Mass | 490.29 |
| IUPAC Name | [(1S,2R,4R,5S,6R,7R,8R,9R,12E)-4,5-diacetyloxy-9,13-dimethyl-3-methylidene-6-propan-2-yl-15-oxatricyclo[6.6.1.02,7]pentadec-12-en-9-yl] butanoate |
| SMILES | C=C1[C@H]2[C@@H]([C@@H](C(C)C)[C@H](OC(C)=O)[C@@H]1OC(C)=O)[C@H]1O[C@H]2C/C(C)=C\CC[C@@]1(C)OC(=O)CCC |
| InChI | InChI=1S/C28H42O7/c1-9-11-21(31)35-28(8)13-10-12-16(4)14-20-23-17(5)25(32-18(6)29)26(33-19(7)30)22(15(2)3)24(23)27(28)34-20/h12,15,20,22-27H,5,9-11,13-14H2,1-4,6-8H3/b16-12-/t20-,22+,23+,24+,25+,26-,27+,28+/m0/s1 |
| InChIKey | GSURVJLXIJFBFS-BXRVMCGNSA-N |
| XLogP | 4.92 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.64 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|