C30H48O9 — CID 51032480
[(1R,2S,3S,4R,5S,6R,7R,8R,9R,12S)-5-acetyloxy-9-butanoyloxy-3,12-dihydroxy-3,9-dimethyl-13-methylidene-6-propan-2-yl-15-oxatricyclo[6.6.1.02,7]pentadecan-4-yl] butanoate (PubChem CID 51032480) has the molecular formula C30H48O9 and a molecular weight of 552.71 g/mol. Its IUPAC name is [(1R,2S,3S,4R,5S,6R,7R,8R,9R,12S)-5-acetyloxy-9-butanoyloxy-3,12-dihydroxy-3,9-dimethyl-13-methylidene-6-propan-2-yl-15-oxatricyclo[6.6.1.02,7]pentadecan-4-yl] butanoate.
| Compound Name | [(1R,2S,3S,4R,5S,6R,7R,8R,9R,12S)-5-acetyloxy-9-butanoyloxy-3,12-dihydroxy-3,9-dimethyl-13-methylidene-6-propan-2-yl-15-oxatricyclo[6.6.1.02,7]pentadecan-4-yl] butanoate |
|---|---|
| PubChem CID | 51032480 |
| Molecular Formula | C30H48O9 |
| Molecular Weight | 552.71 g/mol |
| Exact Mass | 552.33 |
| IUPAC Name | [(1R,2S,3S,4R,5S,6R,7R,8R,9R,12S)-5-acetyloxy-9-butanoyloxy-3,12-dihydroxy-3,9-dimethyl-13-methylidene-6-propan-2-yl-15-oxatricyclo[6.6.1.02,7]pentadecan-4-yl] butanoate |
| SMILES | C=C1C[C@H]2O[C@H]([C@@H]3[C@@H](C(C)C)[C@H](OC(C)=O)[C@@H](OC(=O)CCC)[C@@](C)(O)[C@@H]32)[C@](C)(OC(=O)CCC)CC[C@@H]1O |
| InChI | InChI=1S/C30H48O9/c1-9-11-21(33)38-28-26(36-18(6)31)23(16(3)4)24-25(30(28,8)35)20-15-17(5)19(32)13-14-29(7,27(24)37-20)39-22(34)12-10-2/h16,19-20,23-28,32,35H,5,9-15H2,1-4,6-8H3/t19-,20+,23+,24+,25+,26-,27+,28+,29+,30-/m0/s1 |
| InChIKey | XTJNGKRAVVVSQD-FNDAXUDASA-N |
| XLogP | 3.87 |
| TPSA | 128.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.71 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|