C28H42O10 — CID 101067711
[(1S,2S,3R,4R,5R,6R,7R,8S,9Z,11R,14S)-5,6,14-triacetyloxy-11-hydroxy-6,10,14-trimethyl-3-propan-2-yl-15-oxatricyclo[6.6.1.02,7]pentadec-9-en-4-yl] acetate (PubChem CID 101067711) has the molecular formula C28H42O10 and a molecular weight of 538.63 g/mol. Its IUPAC name is [(1S,2S,3R,4R,5R,6R,7R,8S,9Z,11R,14S)-5,6,14-triacetyloxy-11-hydroxy-6,10,14-trimethyl-3-propan-2-yl-15-oxatricyclo[6.6.1.02,7]pentadec-9-en-4-yl] acetate.
| Compound Name | [(1S,2S,3R,4R,5R,6R,7R,8S,9Z,11R,14S)-5,6,14-triacetyloxy-11-hydroxy-6,10,14-trimethyl-3-propan-2-yl-15-oxatricyclo[6.6.1.02,7]pentadec-9-en-4-yl] acetate |
|---|---|
| PubChem CID | 101067711 |
| Molecular Formula | C28H42O10 |
| Molecular Weight | 538.63 g/mol |
| Exact Mass | 538.28 |
| IUPAC Name | [(1S,2S,3R,4R,5R,6R,7R,8S,9Z,11R,14S)-5,6,14-triacetyloxy-11-hydroxy-6,10,14-trimethyl-3-propan-2-yl-15-oxatricyclo[6.6.1.02,7]pentadec-9-en-4-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@H](C(C)C)[C@H]2[C@H]([C@@H]3/C=C(/C)[C@H](O)CC[C@](C)(OC(C)=O)[C@H]2O3)[C@@](C)(OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C28H42O10/c1-13(2)21-22-23(28(9,38-18(7)32)26(35-16(5)30)24(21)34-15(4)29)20-12-14(3)19(33)10-11-27(8,25(22)36-20)37-17(6)31/h12-13,19-26,33H,10-11H2,1-9H3/b14-12-/t19-,20+,21-,22+,23+,24-,25+,26-,27+,28-/m1/s1 |
| InChIKey | NZXPVYKFJWQKJS-NVOALTPRSA-N |
| XLogP | 2.88 |
| TPSA | 134.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.63 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|