C28H40O10 — CID 73195399
(5,6,14-triacetyloxy-6,14-dimethyl-10-methylidene-11-oxo-3-propan-2-yl-15-oxatricyclo[6.6.1.02,7]pentadecan-4-yl) acetate (PubChem CID 73195399) has the molecular formula C28H40O10 and a molecular weight of 536.62 g/mol. Its IUPAC name is (5,6,14-triacetyloxy-6,14-dimethyl-10-methylidene-11-oxo-3-propan-2-yl-15-oxatricyclo[6.6.1.02,7]pentadecan-4-yl) acetate.
| Compound Name | (5,6,14-triacetyloxy-6,14-dimethyl-10-methylidene-11-oxo-3-propan-2-yl-15-oxatricyclo[6.6.1.02,7]pentadecan-4-yl) acetate |
|---|---|
| PubChem CID | 73195399 |
| Molecular Formula | C28H40O10 |
| Molecular Weight | 536.62 g/mol |
| Exact Mass | 536.26 |
| IUPAC Name | (5,6,14-triacetyloxy-6,14-dimethyl-10-methylidene-11-oxo-3-propan-2-yl-15-oxatricyclo[6.6.1.02,7]pentadecan-4-yl) acetate |
| SMILES | C=C1CC2OC(C3C(C(C)C)C(OC(C)=O)C(OC(C)=O)C(C)(OC(C)=O)C23)C(C)(OC(C)=O)CCC1=O |
| InChI | InChI=1S/C28H40O10/c1-13(2)21-22-23(28(9,38-18(7)32)26(35-16(5)30)24(21)34-15(4)29)20-12-14(3)19(33)10-11-27(8,25(22)36-20)37-17(6)31/h13,20-26H,3,10-12H2,1-2,4-9H3 |
| InChIKey | YKSLBYZFYSYHQK-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 131.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.62 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|