C24H38O6 — CID 163114590
(12-hydroperoxy-4-hydroxy-9-methyl-3,13-dimethylidene-6-propan-2-yl-15-oxatricyclo[6.6.1.02,7]pentadecan-9-yl) butanoate (PubChem CID 163114590) has the molecular formula C24H38O6 and a molecular weight of 422.56 g/mol. Its IUPAC name is (12-hydroperoxy-4-hydroxy-9-methyl-3,13-dimethylidene-6-propan-2-yl-15-oxatricyclo[6.6.1.02,7]pentadecan-9-yl) butanoate.
| Compound Name | (12-hydroperoxy-4-hydroxy-9-methyl-3,13-dimethylidene-6-propan-2-yl-15-oxatricyclo[6.6.1.02,7]pentadecan-9-yl) butanoate |
|---|---|
| PubChem CID | 163114590 |
| Molecular Formula | C24H38O6 |
| Molecular Weight | 422.56 g/mol |
| Exact Mass | 422.27 |
| IUPAC Name | (12-hydroperoxy-4-hydroxy-9-methyl-3,13-dimethylidene-6-propan-2-yl-15-oxatricyclo[6.6.1.02,7]pentadecan-9-yl) butanoate |
| SMILES | C=C1CC2OC(C3C(C(C)C)CC(O)C(=C)C23)C(C)(OC(=O)CCC)CCC1OO |
| InChI | InChI=1S/C24H38O6/c1-7-8-20(26)29-24(6)10-9-18(30-27)14(4)11-19-21-15(5)17(25)12-16(13(2)3)22(21)23(24)28-19/h13,16-19,21-23,25,27H,4-5,7-12H2,1-3,6H3 |
| InChIKey | VSYPXRKYQYAGAE-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.56 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|