C26H40O7 — CID 71574093
[(1R,2R,6R,7R,8R,9R,10S,12S)-6-[(2R)-1-acetyloxypropan-2-yl]-9,12-dihydroxy-9-methyl-3,13-dimethylidene-15-oxatricyclo[6.6.1.02,7]pentadecan-10-yl] butanoate (PubChem CID 71574093) has the molecular formula C26H40O7 and a molecular weight of 464.60 g/mol. Its IUPAC name is [(1R,2R,6R,7R,8R,9R,10S,12S)-6-[(2R)-1-acetyloxypropan-2-yl]-9,12-dihydroxy-9-methyl-3,13-dimethylidene-15-oxatricyclo[6.6.1.02,7]pentadecan-10-yl] butanoate.
| Compound Name | [(1R,2R,6R,7R,8R,9R,10S,12S)-6-[(2R)-1-acetyloxypropan-2-yl]-9,12-dihydroxy-9-methyl-3,13-dimethylidene-15-oxatricyclo[6.6.1.02,7]pentadecan-10-yl] butanoate |
|---|---|
| PubChem CID | 71574093 |
| Molecular Formula | C26H40O7 |
| Molecular Weight | 464.60 g/mol |
| Exact Mass | 464.28 |
| IUPAC Name | [(1R,2R,6R,7R,8R,9R,10S,12S)-6-[(2R)-1-acetyloxypropan-2-yl]-9,12-dihydroxy-9-methyl-3,13-dimethylidene-15-oxatricyclo[6.6.1.02,7]pentadecan-10-yl] butanoate |
| SMILES | C=C1CC[C@H]([C@@H](C)COC(C)=O)[C@@H]2[C@H]1[C@H]1CC(=C)[C@@H](O)C[C@H](OC(=O)CCC)[C@@](C)(O)[C@@H]2O1 |
| InChI | InChI=1S/C26H40O7/c1-7-8-22(29)33-21-12-19(28)15(3)11-20-23-14(2)9-10-18(16(4)13-31-17(5)27)24(23)25(32-20)26(21,6)30/h16,18-21,23-25,28,30H,2-3,7-13H2,1,4-6H3/t16-,18+,19-,20+,21-,23+,24+,25+,26+/m0/s1 |
| InChIKey | MMJVKGXWAOFKAS-UKJKGPNMSA-N |
| XLogP | 3.33 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.60 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|