C22H34O5 — CID 162861523
[(1R,2R,5S,6R,7R,8R,9R,10S)-5,9-dihydroxy-3,9,13-trimethyl-6-propan-2-yl-15-oxatricyclo[6.6.1.02,7]pentadeca-3,12-dien-10-yl] acetate (PubChem CID 162861523) has the molecular formula C22H34O5 and a molecular weight of 378.51 g/mol. Its IUPAC name is [(1R,2R,5S,6R,7R,8R,9R,10S)-5,9-dihydroxy-3,9,13-trimethyl-6-propan-2-yl-15-oxatricyclo[6.6.1.02,7]pentadeca-3,12-dien-10-yl] acetate.
| Compound Name | [(1R,2R,5S,6R,7R,8R,9R,10S)-5,9-dihydroxy-3,9,13-trimethyl-6-propan-2-yl-15-oxatricyclo[6.6.1.02,7]pentadeca-3,12-dien-10-yl] acetate |
|---|---|
| PubChem CID | 162861523 |
| Molecular Formula | C22H34O5 |
| Molecular Weight | 378.51 g/mol |
| Exact Mass | 378.24 |
| IUPAC Name | [(1R,2R,5S,6R,7R,8R,9R,10S)-5,9-dihydroxy-3,9,13-trimethyl-6-propan-2-yl-15-oxatricyclo[6.6.1.02,7]pentadeca-3,12-dien-10-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC=C(C)C[C@H]2O[C@H]([C@H]3[C@@H]2C(C)=C[C@@H](O)[C@@H]3C(C)C)[C@]1(C)O |
| InChI | InChI=1S/C22H34O5/c1-11(2)18-15(24)10-13(4)19-16-9-12(3)7-8-17(26-14(5)23)22(6,25)21(27-16)20(18)19/h7,10-11,15-21,24-25H,8-9H2,1-6H3/t15-,16-,17+,18+,19-,20-,21-,22-/m1/s1 |
| InChIKey | FNKJUTFXJWBXIE-NBWOUMIXSA-N |
| XLogP | 3.00 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.51 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|