C24H36O7 — CID 102458565
[(1R,2R,5S,6R,7S,8R,9R,10S,12Z)-5-acetyloxy-9-hydroxy-6-(2-hydroxypropan-2-yl)-3,9,13-trimethyl-15-oxatricyclo[6.6.1.02,7]pentadeca-3,12-dien-10-yl] acetate (PubChem CID 102458565) has the molecular formula C24H36O7 and a molecular weight of 436.55 g/mol. Its IUPAC name is [(1R,2R,5S,6R,7S,8R,9R,10S,12Z)-5-acetyloxy-9-hydroxy-6-(2-hydroxypropan-2-yl)-3,9,13-trimethyl-15-oxatricyclo[6.6.1.02,7]pentadeca-3,12-dien-10-yl] acetate.
| Compound Name | [(1R,2R,5S,6R,7S,8R,9R,10S,12Z)-5-acetyloxy-9-hydroxy-6-(2-hydroxypropan-2-yl)-3,9,13-trimethyl-15-oxatricyclo[6.6.1.02,7]pentadeca-3,12-dien-10-yl] acetate |
|---|---|
| PubChem CID | 102458565 |
| Molecular Formula | C24H36O7 |
| Molecular Weight | 436.55 g/mol |
| Exact Mass | 436.25 |
| IUPAC Name | [(1R,2R,5S,6R,7S,8R,9R,10S,12Z)-5-acetyloxy-9-hydroxy-6-(2-hydroxypropan-2-yl)-3,9,13-trimethyl-15-oxatricyclo[6.6.1.02,7]pentadeca-3,12-dien-10-yl] acetate |
| SMILES | CC(=O)O[C@H]1C=C(C)[C@H]2[C@@H]([C@H]1C(C)(C)O)[C@H]1O[C@@H]2C/C(C)=C\C[C@H](OC(C)=O)[C@@]1(C)O |
| InChI | InChI=1S/C24H36O7/c1-12-8-9-18(30-15(4)26)24(7,28)22-20-19(16(10-12)31-22)13(2)11-17(29-14(3)25)21(20)23(5,6)27/h8,11,16-22,27-28H,9-10H2,1-7H3/b12-8-/t16-,17+,18+,19-,20+,21+,22-,24-/m1/s1 |
| InChIKey | AMJWWBIYKZSOFC-LJNVXACHSA-N |
| XLogP | 2.69 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.55 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|