C32H52O8Si — CID 11541650
[(1R,2S,3R,4R,7R,8R,11S,14R)-4-acetyloxy-3-(2-acetyloxypropan-2-yl)-6,14-dimethyl-10-methylidene-14-triethylsilyloxy-15-oxatricyclo[6.6.1.02,7]pentadec-5-en-11-yl] acetate (PubChem CID 11541650) has the molecular formula C32H52O8Si and a molecular weight of 592.85 g/mol. Its IUPAC name is [(1R,2S,3R,4R,7R,8R,11S,14R)-4-acetyloxy-3-(2-acetyloxypropan-2-yl)-6,14-dimethyl-10-methylidene-14-triethylsilyloxy-15-oxatricyclo[6.6.1.02,7]pentadec-5-en-11-yl] acetate.
| Compound Name | [(1R,2S,3R,4R,7R,8R,11S,14R)-4-acetyloxy-3-(2-acetyloxypropan-2-yl)-6,14-dimethyl-10-methylidene-14-triethylsilyloxy-15-oxatricyclo[6.6.1.02,7]pentadec-5-en-11-yl] acetate |
|---|---|
| PubChem CID | 11541650 |
| Molecular Formula | C32H52O8Si |
| Molecular Weight | 592.85 g/mol |
| Exact Mass | 592.34 |
| IUPAC Name | [(1R,2S,3R,4R,7R,8R,11S,14R)-4-acetyloxy-3-(2-acetyloxypropan-2-yl)-6,14-dimethyl-10-methylidene-14-triethylsilyloxy-15-oxatricyclo[6.6.1.02,7]pentadec-5-en-11-yl] acetate |
| SMILES | C=C1C[C@H]2O[C@H]([C@H]3[C@@H]2C(C)=C[C@@H](OC(C)=O)[C@@H]3C(C)(C)OC(C)=O)[C@](C)(O[Si](CC)(CC)CC)CC[C@@H]1OC(C)=O |
| InChI | InChI=1S/C32H52O8Si/c1-12-41(13-2,14-3)40-32(11)16-15-24(36-21(6)33)19(4)17-25-27-20(5)18-26(37-22(7)34)29(28(27)30(32)38-25)31(9,10)39-23(8)35/h18,24-30H,4,12-17H2,1-3,5-11H3/t24-,25+,26+,27+,28-,29-,30+,32+/m0/s1 |
| InChIKey | YBLLFINGVQYTTK-ZJCIRQSSSA-N |
| XLogP | 6.29 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.85 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|