C40H64O4 — CID 139092520
(1R,2R,6R,7R,8R,9R,12E)-9,13-dimethyl-3-methylidene-6-propan-2-yl-15-oxatricyclo[6.6.1.02,7]pentadec-12-en-9-ol (PubChem CID 139092520) has the molecular formula C40H64O4 and a molecular weight of 608.95 g/mol. Its IUPAC name is (1R,2R,6R,7R,8R,9R,12E)-9,13-dimethyl-3-methylidene-6-propan-2-yl-15-oxatricyclo[6.6.1.02,7]pentadec-12-en-9-ol.
| Compound Name | (1R,2R,6R,7R,8R,9R,12E)-9,13-dimethyl-3-methylidene-6-propan-2-yl-15-oxatricyclo[6.6.1.02,7]pentadec-12-en-9-ol |
|---|---|
| PubChem CID | 139092520 |
| Molecular Formula | C40H64O4 |
| Molecular Weight | 608.95 g/mol |
| Exact Mass | 608.48 |
| IUPAC Name | (1R,2R,6R,7R,8R,9R,12E)-9,13-dimethyl-3-methylidene-6-propan-2-yl-15-oxatricyclo[6.6.1.02,7]pentadec-12-en-9-ol |
| SMILES | C=C1CC[C@H](C(C)C)[C@@H]2[C@H]1[C@H]1C/C(C)=C\CC[C@@](C)(O)[C@@H]2O1.C=C1CC[C@H](C(C)C)[C@@H]2[C@H]1[C@H]1C/C(C)=C\CC[C@@](C)(O)[C@@H]2O1 |
| InChI | InChI=1S/2C20H32O2/c2*1-12(2)15-9-8-14(4)17-16-11-13(3)7-6-10-20(5,21)19(22-16)18(15)17/h2*7,12,15-19,21H,4,6,8-11H2,1-3,5H3/b2*13-7-/t2*15-,16-,17-,18-,19-,20-/m11/s1 |
| InChIKey | NJKKYMCWMGFYTG-VPNAZHPPSA-N |
| XLogP | 8.98 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.95 |
| LogP ≤ 5 | 8.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|