C34H38ClNO5 — CID 174679764
(3R,4R,5R,6R)-3-amino-2,4,5-tribenzyl-6-(phenylmethoxymethyl)oxane-2,4,5-triol;hydrochloride (PubChem CID 174679764) has the molecular formula C34H38ClNO5 and a molecular weight of 576.13 g/mol. Its IUPAC name is (3R,4R,5R,6R)-3-amino-2,4,5-tribenzyl-6-(phenylmethoxymethyl)oxane-2,4,5-triol;hydrochloride.
| Compound Name | (3R,4R,5R,6R)-3-amino-2,4,5-tribenzyl-6-(phenylmethoxymethyl)oxane-2,4,5-triol;hydrochloride |
|---|---|
| PubChem CID | 174679764 |
| Molecular Formula | C34H38ClNO5 |
| Molecular Weight | 576.13 g/mol |
| Exact Mass | 575.24 |
| IUPAC Name | (3R,4R,5R,6R)-3-amino-2,4,5-tribenzyl-6-(phenylmethoxymethyl)oxane-2,4,5-triol;hydrochloride |
| SMILES | Cl.N[C@H]1C(O)(Cc2ccccc2)O[C@H](COCc2ccccc2)[C@](O)(Cc2ccccc2)[C@@]1(O)Cc1ccccc1 |
| InChI | InChI=1S/C34H37NO5.ClH/c35-31-33(37,22-27-15-7-2-8-16-27)32(36,21-26-13-5-1-6-14-26)30(25-39-24-29-19-11-4-12-20-29)40-34(31,38)23-28-17-9-3-10-18-28;/h1-20,30-31,36-38H,21-25,35H2;1H/t30-,31-,32-,33-,34?;/m1./s1 |
| InChIKey | FWCWBUACRSBIQP-XTNXPORCSA-N |
| XLogP | 4.23 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.13 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |