C28H30F2O6 — CID 86619972
(2S,3R,4R,6R)-5,5-difluoro-2-methoxy-3,4-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-ol (PubChem CID 86619972) has the molecular formula C28H30F2O6 and a molecular weight of 500.54 g/mol. Its IUPAC name is (2S,3R,4R,6R)-5,5-difluoro-2-methoxy-3,4-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-ol.
| Compound Name | (2S,3R,4R,6R)-5,5-difluoro-2-methoxy-3,4-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-ol |
|---|---|
| PubChem CID | 86619972 |
| Molecular Formula | C28H30F2O6 |
| Molecular Weight | 500.54 g/mol |
| Exact Mass | 500.20 |
| IUPAC Name | (2S,3R,4R,6R)-5,5-difluoro-2-methoxy-3,4-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-ol |
| SMILES | CO[C@]1(O)O[C@H](COCc2ccccc2)C(F)(F)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C28H30F2O6/c1-32-28(31)26(35-19-23-15-9-4-10-16-23)25(34-18-22-13-7-3-8-14-22)27(29,30)24(36-28)20-33-17-21-11-5-2-6-12-21/h2-16,24-26,31H,17-20H2,1H3/t24-,25-,26-,28+/m1/s1 |
| InChIKey | DFNCXCXUFAMOML-LHWXFDGDSA-N |
| XLogP | 4.70 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.54 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|