C27H28F2O5 — CID 153362035
5,5-difluoro-2,3-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-ol (PubChem CID 153362035) has the molecular formula C27H28F2O5 and a molecular weight of 470.51 g/mol. Its IUPAC name is 5,5-difluoro-2,3-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-ol.
| Compound Name | 5,5-difluoro-2,3-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-ol |
|---|---|
| PubChem CID | 153362035 |
| Molecular Formula | C27H28F2O5 |
| Molecular Weight | 470.51 g/mol |
| Exact Mass | 470.19 |
| IUPAC Name | 5,5-difluoro-2,3-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-ol |
| SMILES | OC1(OCc2ccccc2)OC(COCc2ccccc2)C(F)(F)CC1OCc1ccccc1 |
| InChI | InChI=1S/C27H28F2O5/c28-26(29)16-24(32-18-22-12-6-2-7-13-22)27(30,33-19-23-14-8-3-9-15-23)34-25(26)20-31-17-21-10-4-1-5-11-21/h1-15,24-25,30H,16-20H2 |
| InChIKey | CSXPGKAZLXFGOW-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.51 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|