C12H15FO4 — CID 142669372
4-fluoro-2-(phenylmethoxymethyl)oxolane-3,4-diol (PubChem CID 142669372) has the molecular formula C12H15FO4 and a molecular weight of 242.25 g/mol. Its IUPAC name is 4-fluoro-2-(phenylmethoxymethyl)oxolane-3,4-diol.
| Compound Name | 4-fluoro-2-(phenylmethoxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 142669372 |
| Molecular Formula | C12H15FO4 |
| Molecular Weight | 242.25 g/mol |
| Exact Mass | 242.10 |
| IUPAC Name | 4-fluoro-2-(phenylmethoxymethyl)oxolane-3,4-diol |
| SMILES | OC1C(COCc2ccccc2)OCC1(O)F |
| InChI | InChI=1S/C12H15FO4/c13-12(15)8-17-10(11(12)14)7-16-6-9-4-2-1-3-5-9/h1-5,10-11,14-15H,6-8H2 |
| InChIKey | GSNHZILYJQOQDD-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.25 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |