C14H20F2OSi — CID 10989341
[(1S,3R)-2,2-difluoro-3-(phenylmethoxymethyl)cyclopropyl]-trimethylsilane (PubChem CID 10989341) has the molecular formula C14H20F2OSi and a molecular weight of 270.39 g/mol. Its IUPAC name is [(1S,3R)-2,2-difluoro-3-(phenylmethoxymethyl)cyclopropyl]-trimethylsilane.
| Compound Name | [(1S,3R)-2,2-difluoro-3-(phenylmethoxymethyl)cyclopropyl]-trimethylsilane |
|---|---|
| PubChem CID | 10989341 |
| Molecular Formula | C14H20F2OSi |
| Molecular Weight | 270.39 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | [(1S,3R)-2,2-difluoro-3-(phenylmethoxymethyl)cyclopropyl]-trimethylsilane |
| SMILES | C[Si](C)(C)[C@H]1[C@H](COCc2ccccc2)C1(F)F |
| InChI | InChI=1S/C14H20F2OSi/c1-18(2,3)13-12(14(13,15)16)10-17-9-11-7-5-4-6-8-11/h4-8,12-13H,9-10H2,1-3H3/t12-,13-/m0/s1 |
| InChIKey | LQLYHLCRMFOTGH-STQMWFEESA-N |
| XLogP | 4.18 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.39 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|