C24H31FO4 — CID 67751523
[(1S,2R,4S)-3,3-diethoxy-2-fluoro-4-(phenylmethoxymethyl)cyclobutyl]methoxymethylbenzene (PubChem CID 67751523) has the molecular formula C24H31FO4 and a molecular weight of 402.51 g/mol. Its IUPAC name is [(1S,2R,4S)-3,3-diethoxy-2-fluoro-4-(phenylmethoxymethyl)cyclobutyl]methoxymethylbenzene.
| Compound Name | [(1S,2R,4S)-3,3-diethoxy-2-fluoro-4-(phenylmethoxymethyl)cyclobutyl]methoxymethylbenzene |
|---|---|
| PubChem CID | 67751523 |
| Molecular Formula | C24H31FO4 |
| Molecular Weight | 402.51 g/mol |
| Exact Mass | 402.22 |
| IUPAC Name | [(1S,2R,4S)-3,3-diethoxy-2-fluoro-4-(phenylmethoxymethyl)cyclobutyl]methoxymethylbenzene |
| SMILES | CCOC1(OCC)[C@H](F)[C@H](COCc2ccccc2)[C@H]1COCc1ccccc1 |
| InChI | InChI=1S/C24H31FO4/c1-3-28-24(29-4-2)22(18-27-16-20-13-9-6-10-14-20)21(23(24)25)17-26-15-19-11-7-5-8-12-19/h5-14,21-23H,3-4,15-18H2,1-2H3/t21-,22-,23-/m1/s1 |
| InChIKey | CGFUMMKKCOUDKC-DNVJHFABSA-N |
| XLogP | 4.77 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.51 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|