C22H32O5 — CID 172722458
2,4-ditert-butyl-3-(phenylmethoxymethyl)cyclobutane-1,1-dicarboxylic acid (PubChem CID 172722458) has the molecular formula C22H32O5 and a molecular weight of 376.49 g/mol. Its IUPAC name is 2,4-ditert-butyl-3-(phenylmethoxymethyl)cyclobutane-1,1-dicarboxylic acid.
| Compound Name | 2,4-ditert-butyl-3-(phenylmethoxymethyl)cyclobutane-1,1-dicarboxylic acid |
|---|---|
| PubChem CID | 172722458 |
| Molecular Formula | C22H32O5 |
| Molecular Weight | 376.49 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | 2,4-ditert-butyl-3-(phenylmethoxymethyl)cyclobutane-1,1-dicarboxylic acid |
| SMILES | CC(C)(C)C1C(COCc2ccccc2)C(C(C)(C)C)C1(C(=O)O)C(=O)O |
| InChI | InChI=1S/C22H32O5/c1-20(2,3)16-15(13-27-12-14-10-8-7-9-11-14)17(21(4,5)6)22(16,18(23)24)19(25)26/h7-11,15-17H,12-13H2,1-6H3,(H,23,24)(H,25,26) |
| InChIKey | GRWVHEUNUITIRB-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.49 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|