C17H25FO4 — CID 67878928
[3,3-diethoxy-1-fluoro-2-(phenylmethoxymethyl)cyclobutyl]methanol (PubChem CID 67878928) has the molecular formula C17H25FO4 and a molecular weight of 312.38 g/mol. Its IUPAC name is [3,3-diethoxy-1-fluoro-2-(phenylmethoxymethyl)cyclobutyl]methanol.
| Compound Name | [3,3-diethoxy-1-fluoro-2-(phenylmethoxymethyl)cyclobutyl]methanol |
|---|---|
| PubChem CID | 67878928 |
| Molecular Formula | C17H25FO4 |
| Molecular Weight | 312.38 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | [3,3-diethoxy-1-fluoro-2-(phenylmethoxymethyl)cyclobutyl]methanol |
| SMILES | CCOC1(OCC)CC(F)(CO)C1COCc1ccccc1 |
| InChI | InChI=1S/C17H25FO4/c1-3-21-17(22-4-2)12-16(18,13-19)15(17)11-20-10-14-8-6-5-7-9-14/h5-9,15,19H,3-4,10-13H2,1-2H3 |
| InChIKey | FSSZHXOLTRRJPZ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.38 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|