C41H42O6 — CID 67924333
(1S,2R,4R,5R)-1,2,3,4,5-pentabenzylcyclohexane-1,2,3,4,5,6-hexol (PubChem CID 67924333) has the molecular formula C41H42O6 and a molecular weight of 630.78 g/mol. Its IUPAC name is (1S,2R,4R,5R)-1,2,3,4,5-pentabenzylcyclohexane-1,2,3,4,5,6-hexol.
| Compound Name | (1S,2R,4R,5R)-1,2,3,4,5-pentabenzylcyclohexane-1,2,3,4,5,6-hexol |
|---|---|
| PubChem CID | 67924333 |
| Molecular Formula | C41H42O6 |
| Molecular Weight | 630.78 g/mol |
| Exact Mass | 630.30 |
| IUPAC Name | (1S,2R,4R,5R)-1,2,3,4,5-pentabenzylcyclohexane-1,2,3,4,5,6-hexol |
| SMILES | OC1[C@](O)(Cc2ccccc2)[C@](O)(Cc2ccccc2)C(O)(Cc2ccccc2)[C@@](O)(Cc2ccccc2)[C@]1(O)Cc1ccccc1 |
| InChI | InChI=1S/C41H42O6/c42-36-37(43,26-31-16-6-1-7-17-31)39(45,28-33-20-10-3-11-21-33)41(47,30-35-24-14-5-15-25-35)40(46,29-34-22-12-4-13-23-34)38(36,44)27-32-18-8-2-9-19-32/h1-25,36,42-47H,26-30H2/t36?,37-,38+,39-,40-,41?/m1/s1 |
| InChIKey | IIDZNMHBLSOXEM-JSOZEKAASA-N |
| XLogP | 4.23 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.78 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |