C20H22O4 — CID 54252696
(2R,3R,4R)-3,4-dibenzyl-2-(hydroxymethyl)-2H-pyran-3,4-diol (PubChem CID 54252696) has the molecular formula C20H22O4 and a molecular weight of 326.39 g/mol. Its IUPAC name is (2R,3R,4R)-3,4-dibenzyl-2-(hydroxymethyl)-2H-pyran-3,4-diol.
| Compound Name | (2R,3R,4R)-3,4-dibenzyl-2-(hydroxymethyl)-2H-pyran-3,4-diol |
|---|---|
| PubChem CID | 54252696 |
| Molecular Formula | C20H22O4 |
| Molecular Weight | 326.39 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | (2R,3R,4R)-3,4-dibenzyl-2-(hydroxymethyl)-2H-pyran-3,4-diol |
| SMILES | OC[C@H]1OC=C[C@](O)(Cc2ccccc2)[C@@]1(O)Cc1ccccc1 |
| InChI | InChI=1S/C20H22O4/c21-15-18-20(23,14-17-9-5-2-6-10-17)19(22,11-12-24-18)13-16-7-3-1-4-8-16/h1-12,18,21-23H,13-15H2/t18-,19+,20-/m1/s1 |
| InChIKey | QXWSYLRQDJYRMJ-HSALFYBXSA-N |
| XLogP | 1.84 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.39 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |