C34H35BrO6 — CID 140502708
(2R,3R,4R,5S,6S)-2,3,4,5-tetrabenzyl-6-bromo-6-(hydroxymethyl)oxane-2,3,4,5-tetrol (PubChem CID 140502708) has the molecular formula C34H35BrO6 and a molecular weight of 619.55 g/mol. Its IUPAC name is (2R,3R,4R,5S,6S)-2,3,4,5-tetrabenzyl-6-bromo-6-(hydroxymethyl)oxane-2,3,4,5-tetrol.
| Compound Name | (2R,3R,4R,5S,6S)-2,3,4,5-tetrabenzyl-6-bromo-6-(hydroxymethyl)oxane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 140502708 |
| Molecular Formula | C34H35BrO6 |
| Molecular Weight | 619.55 g/mol |
| Exact Mass | 618.16 |
| IUPAC Name | (2R,3R,4R,5S,6S)-2,3,4,5-tetrabenzyl-6-bromo-6-(hydroxymethyl)oxane-2,3,4,5-tetrol |
| SMILES | OC[C@@]1(Br)O[C@](O)(Cc2ccccc2)[C@@](O)(Cc2ccccc2)[C@](O)(Cc2ccccc2)[C@@]1(O)Cc1ccccc1 |
| InChI | InChI=1S/C34H35BrO6/c35-33(25-36)31(38,22-27-15-7-2-8-16-27)30(37,21-26-13-5-1-6-14-26)32(39,23-28-17-9-3-10-18-28)34(40,41-33)24-29-19-11-4-12-20-29/h1-20,36-40H,21-25H2/t30-,31-,32+,33+,34+/m0/s1 |
| InChIKey | ZGFYOAGYQQBLPB-VHFAWWBMSA-N |
| XLogP | 3.95 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.55 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|