C13H19NO6 — CID 141389802
(2S,3S,4R,5S)-6-amino-6-benzyl-2-(hydroxymethyl)oxane-2,3,4,5-tetrol (PubChem CID 141389802) has the molecular formula C13H19NO6 and a molecular weight of 285.30 g/mol. Its IUPAC name is (2S,3S,4R,5S)-6-amino-6-benzyl-2-(hydroxymethyl)oxane-2,3,4,5-tetrol.
| Compound Name | (2S,3S,4R,5S)-6-amino-6-benzyl-2-(hydroxymethyl)oxane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 141389802 |
| Molecular Formula | C13H19NO6 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | (2S,3S,4R,5S)-6-amino-6-benzyl-2-(hydroxymethyl)oxane-2,3,4,5-tetrol |
| SMILES | NC1(Cc2ccccc2)O[C@@](O)(CO)[C@@H](O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C13H19NO6/c14-12(6-8-4-2-1-3-5-8)10(17)9(16)11(18)13(19,7-15)20-12/h1-5,9-11,15-19H,6-7,14H2/t9-,10+,11+,12?,13+/m1/s1 |
| InChIKey | WDNVHNSWUZGCFD-GRZVIAIVSA-N |
| XLogP | -2.32 |
| TPSA | 136.40 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | -2.32 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |