C13H15ClO4 — CID 57024548
(1R,2R,3R,4R,5R)-2-benzyl-3-chloro-6,8-dioxabicyclo[3.2.1]octane-2,4-diol (PubChem CID 57024548) has the molecular formula C13H15ClO4 and a molecular weight of 270.71 g/mol. Its IUPAC name is (1R,2R,3R,4R,5R)-2-benzyl-3-chloro-6,8-dioxabicyclo[3.2.1]octane-2,4-diol.
| Compound Name | (1R,2R,3R,4R,5R)-2-benzyl-3-chloro-6,8-dioxabicyclo[3.2.1]octane-2,4-diol |
|---|---|
| PubChem CID | 57024548 |
| Molecular Formula | C13H15ClO4 |
| Molecular Weight | 270.71 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | (1R,2R,3R,4R,5R)-2-benzyl-3-chloro-6,8-dioxabicyclo[3.2.1]octane-2,4-diol |
| SMILES | O[C@@H]1[C@@H]2OC[C@@H](O2)[C@](O)(Cc2ccccc2)[C@@H]1Cl |
| InChI | InChI=1S/C13H15ClO4/c14-11-10(15)12-17-7-9(18-12)13(11,16)6-8-4-2-1-3-5-8/h1-5,9-12,15-16H,6-7H2/t9-,10+,11-,12-,13-/m1/s1 |
| InChIKey | NNZXZGTWCQHNIL-NZEXEKPDSA-N |
| XLogP | 0.68 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.71 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|