C19H31BrO5Si — CID 57220767
(2R,3R,4S,5S,6S)-3-benzyl-2-bromo-6-[[tert-butyl(dimethyl)silyl]-hydroxymethyl]oxane-3,4,5-triol (PubChem CID 57220767) has the molecular formula C19H31BrO5Si and a molecular weight of 447.44 g/mol. Its IUPAC name is (2R,3R,4S,5S,6S)-3-benzyl-2-bromo-6-[[tert-butyl(dimethyl)silyl]-hydroxymethyl]oxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5S,6S)-3-benzyl-2-bromo-6-[[tert-butyl(dimethyl)silyl]-hydroxymethyl]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 57220767 |
| Molecular Formula | C19H31BrO5Si |
| Molecular Weight | 447.44 g/mol |
| Exact Mass | 446.11 |
| IUPAC Name | (2R,3R,4S,5S,6S)-3-benzyl-2-bromo-6-[[tert-butyl(dimethyl)silyl]-hydroxymethyl]oxane-3,4,5-triol |
| SMILES | CC(C)(C)[Si](C)(C)C(O)[C@H]1O[C@H](Br)[C@@](O)(Cc2ccccc2)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C19H31BrO5Si/c1-18(2,3)26(4,5)16(23)14-13(21)15(22)19(24,17(20)25-14)11-12-9-7-6-8-10-12/h6-10,13-17,21-24H,11H2,1-5H3/t13-,14+,15+,16?,17+,19-/m1/s1 |
| InChIKey | KTRYWXJBHPNNCO-QXALCELXSA-N |
| XLogP | 2.21 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.44 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|