C46H44O6 — CID 154508744
(3R,4S,5R,6R)-3-benzyl-2,4-bis(phenylmethoxy)-6-(trityloxymethyl)oxane-3,5-diol (PubChem CID 154508744) has the molecular formula C46H44O6 and a molecular weight of 692.85 g/mol. Its IUPAC name is (3R,4S,5R,6R)-3-benzyl-2,4-bis(phenylmethoxy)-6-(trityloxymethyl)oxane-3,5-diol.
| Compound Name | (3R,4S,5R,6R)-3-benzyl-2,4-bis(phenylmethoxy)-6-(trityloxymethyl)oxane-3,5-diol |
|---|---|
| PubChem CID | 154508744 |
| Molecular Formula | C46H44O6 |
| Molecular Weight | 692.85 g/mol |
| Exact Mass | 692.31 |
| IUPAC Name | (3R,4S,5R,6R)-3-benzyl-2,4-bis(phenylmethoxy)-6-(trityloxymethyl)oxane-3,5-diol |
| SMILES | O[C@@H]1[C@@H](COC(c2ccccc2)(c2ccccc2)c2ccccc2)OC(OCc2ccccc2)[C@@](O)(Cc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C46H44O6/c47-42-41(34-51-46(38-25-13-4-14-26-38,39-27-15-5-16-28-39)40-29-17-6-18-30-40)52-44(50-33-37-23-11-3-12-24-37)45(48,31-35-19-7-1-8-20-35)43(42)49-32-36-21-9-2-10-22-36/h1-30,41-44,47-48H,31-34H2/t41-,42-,43+,44?,45-/m1/s1 |
| InChIKey | LWYWYNYRUWBGNU-LOLABWHPSA-N |
| XLogP | 7.86 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.85 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|