C25H25IO5 — CID 171122589
(2R,3R,4R,5R,6S)-3-iodo-6-(trityloxymethyl)oxane-2,4,5-triol (PubChem CID 171122589) has the molecular formula C25H25IO5 and a molecular weight of 532.37 g/mol. Its IUPAC name is (2R,3R,4R,5R,6S)-3-iodo-6-(trityloxymethyl)oxane-2,4,5-triol.
| Compound Name | (2R,3R,4R,5R,6S)-3-iodo-6-(trityloxymethyl)oxane-2,4,5-triol |
|---|---|
| PubChem CID | 171122589 |
| Molecular Formula | C25H25IO5 |
| Molecular Weight | 532.37 g/mol |
| Exact Mass | 532.07 |
| IUPAC Name | (2R,3R,4R,5R,6S)-3-iodo-6-(trityloxymethyl)oxane-2,4,5-triol |
| SMILES | O[C@@H]1[C@@H](O)[C@H](COC(c2ccccc2)(c2ccccc2)c2ccccc2)O[C@@H](O)[C@@H]1I |
| InChI | InChI=1S/C25H25IO5/c26-21-23(28)22(27)20(31-24(21)29)16-30-25(17-10-4-1-5-11-17,18-12-6-2-7-13-18)19-14-8-3-9-15-19/h1-15,20-24,27-29H,16H2/t20-,21+,22-,23-,24+/m0/s1 |
| InChIKey | KRFLGBMVIFEABC-VHJOFQCFSA-N |
| XLogP | 3.24 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.37 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|