C27H28O6 — CID 24755739
(3aR,5R,6S,7S,7aR)-2-methyl-5-(trityloxymethyl)-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran-6,7-diol (PubChem CID 24755739) has the molecular formula C27H28O6 and a molecular weight of 448.52 g/mol. Its IUPAC name is (3aR,5R,6S,7S,7aR)-2-methyl-5-(trityloxymethyl)-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran-6,7-diol.
| Compound Name | (3aR,5R,6S,7S,7aR)-2-methyl-5-(trityloxymethyl)-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran-6,7-diol |
|---|---|
| PubChem CID | 24755739 |
| Molecular Formula | C27H28O6 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.19 |
| IUPAC Name | (3aR,5R,6S,7S,7aR)-2-methyl-5-(trityloxymethyl)-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran-6,7-diol |
| SMILES | CC1O[C@H]2O[C@H](COC(c3ccccc3)(c3ccccc3)c3ccccc3)[C@@H](O)[C@H](O)[C@H]2O1 |
| InChI | InChI=1S/C27H28O6/c1-18-31-25-24(29)23(28)22(33-26(25)32-18)17-30-27(19-11-5-2-6-12-19,20-13-7-3-8-14-20)21-15-9-4-10-16-21/h2-16,18,22-26,28-29H,17H2,1H3/t18?,22-,23-,24+,25-,26+/m1/s1 |
| InChIKey | RODINYQHCQPDQI-ZCQYBHQDSA-N |
| XLogP | 3.20 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|