C13H18N2O6S — CID 71478256
N'-[(3S,4S,5R)-3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]-2-sulfanylbenzohydrazide (PubChem CID 71478256) has the molecular formula C13H18N2O6S and a molecular weight of 330.36 g/mol. Its IUPAC name is N'-[(3S,4S,5R)-3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]-2-sulfanylbenzohydrazide.
| Compound Name | N'-[(3S,4S,5R)-3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]-2-sulfanylbenzohydrazide |
|---|---|
| PubChem CID | 71478256 |
| Molecular Formula | C13H18N2O6S |
| Molecular Weight | 330.36 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | N'-[(3S,4S,5R)-3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]-2-sulfanylbenzohydrazide |
| SMILES | O=C(NNC1(CO)O[C@H](CO)[C@@H](O)[C@@H]1O)c1ccccc1S |
| InChI | InChI=1S/C13H18N2O6S/c16-5-8-10(18)11(19)13(6-17,21-8)15-14-12(20)7-3-1-2-4-9(7)22/h1-4,8,10-11,15-19,22H,5-6H2,(H,14,20)/t8-,10-,11+,13?/m1/s1 |
| InChIKey | WMCQMSSTRBRCBR-SJKQPDGISA-N |
| XLogP | -1.99 |
| TPSA | 131.28 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.36 |
| LogP ≤ 5 | -1.99 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|