C25H27N3O11 — CID 70117642
N-(2-oxo-1H-pyrimidin-6-yl)-N-[(2R,3R,4S,5R,6R)-3,4,5-triacetyl-3,4,5-trihydroxy-6-(1-hydroxy-2-oxopropyl)oxan-2-yl]benzamide (PubChem CID 70117642) has the molecular formula C25H27N3O11 and a molecular weight of 545.50 g/mol. Its IUPAC name is N-(2-oxo-1H-pyrimidin-6-yl)-N-[(2R,3R,4S,5R,6R)-3,4,5-triacetyl-3,4,5-trihydroxy-6-(1-hydroxy-2-oxopropyl)oxan-2-yl]benzamide.
| Compound Name | N-(2-oxo-1H-pyrimidin-6-yl)-N-[(2R,3R,4S,5R,6R)-3,4,5-triacetyl-3,4,5-trihydroxy-6-(1-hydroxy-2-oxopropyl)oxan-2-yl]benzamide |
|---|---|
| PubChem CID | 70117642 |
| Molecular Formula | C25H27N3O11 |
| Molecular Weight | 545.50 g/mol |
| Exact Mass | 545.16 |
| IUPAC Name | N-(2-oxo-1H-pyrimidin-6-yl)-N-[(2R,3R,4S,5R,6R)-3,4,5-triacetyl-3,4,5-trihydroxy-6-(1-hydroxy-2-oxopropyl)oxan-2-yl]benzamide |
| SMILES | CC(=O)C(O)[C@H]1O[C@@H](N(C(=O)c2ccccc2)c2ccnc(=O)[nH]2)[C@@](O)(C(C)=O)[C@](O)(C(C)=O)[C@@]1(O)C(C)=O |
| InChI | InChI=1S/C25H27N3O11/c1-12(29)18(33)19-23(36,13(2)30)25(38,15(4)32)24(37,14(3)31)21(39-19)28(17-10-11-26-22(35)27-17)20(34)16-8-6-5-7-9-16/h5-11,18-19,21,33,36-38H,1-4H3,(H,26,27,35)/t18?,19-,21-,23-,24+,25+/m1/s1 |
| InChIKey | GAYVKXXDIBBKRL-KFUZLIGISA-N |
| XLogP | -1.95 |
| TPSA | 224.49 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.50 |
| LogP ≤ 5 | -1.95 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |