C38H59F3NO11S+ — CID 160717475
tetrabutylazanium;4,4,4-trifluoro-1-thiophen-2-yl-3-[(3R,4S,5S,6R)-3,4,5-triacetyl-3,4,5-trihydroxy-6-(1-hydroxy-2-oxopropyl)oxan-2-yl]oxybut-2-en-1-one (PubChem CID 160717475) has the molecular formula C38H59F3NO11S+ and a molecular weight of 794.95 g/mol. Its IUPAC name is tetrabutylazanium;4,4,4-trifluoro-1-thiophen-2-yl-3-[(3R,4S,5S,6R)-3,4,5-triacetyl-3,4,5-trihydroxy-6-(1-hydroxy-2-oxopropyl)oxan-2-yl]oxybut-2-en-1-one.
| Compound Name | tetrabutylazanium;4,4,4-trifluoro-1-thiophen-2-yl-3-[(3R,4S,5S,6R)-3,4,5-triacetyl-3,4,5-trihydroxy-6-(1-hydroxy-2-oxopropyl)oxan-2-yl]oxybut-2-en-1-one |
|---|---|
| PubChem CID | 160717475 |
| Molecular Formula | C38H59F3NO11S+ |
| Molecular Weight | 794.95 g/mol |
| Exact Mass | 794.38 |
| IUPAC Name | tetrabutylazanium;4,4,4-trifluoro-1-thiophen-2-yl-3-[(3R,4S,5S,6R)-3,4,5-triacetyl-3,4,5-trihydroxy-6-(1-hydroxy-2-oxopropyl)oxan-2-yl]oxybut-2-en-1-one |
| SMILES | CC(=O)C(O)[C@H]1OC(OC(=CC(=O)c2cccs2)C(F)(F)F)[C@@](O)(C(C)=O)[C@](O)(C(C)=O)[C@]1(O)C(C)=O.CCCC[N+](CCCC)(CCCC)CCCC |
| InChI | InChI=1S/C22H23F3O11S.C16H36N/c1-9(26)16(31)17-19(32,10(2)27)21(34,12(4)29)20(33,11(3)28)18(36-17)35-15(22(23,24)25)8-13(30)14-6-5-7-37-14;1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4/h5-8,16-18,31-34H,1-4H3;5-16H2,1-4H3/q;+1/t16?,17-,18?,19+,20+,21+;/m1./s1 |
| InChIKey | RSQWKFAVTRHFEV-LNHWAEGLSA-N |
| XLogP | 5.03 |
| TPSA | 184.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 794.95 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|