C32H36O8 — CID 67854114
[(2S,3R,4S,5R,6R)-6-acetyloxy-4,5-dibenzyl-4,5-dihydroxy-2-(1-hydroxy-2-phenylethyl)oxan-3-yl]methyl acetate (PubChem CID 67854114) has the molecular formula C32H36O8 and a molecular weight of 548.63 g/mol. Its IUPAC name is [(2S,3R,4S,5R,6R)-6-acetyloxy-4,5-dibenzyl-4,5-dihydroxy-2-(1-hydroxy-2-phenylethyl)oxan-3-yl]methyl acetate.
| Compound Name | [(2S,3R,4S,5R,6R)-6-acetyloxy-4,5-dibenzyl-4,5-dihydroxy-2-(1-hydroxy-2-phenylethyl)oxan-3-yl]methyl acetate |
|---|---|
| PubChem CID | 67854114 |
| Molecular Formula | C32H36O8 |
| Molecular Weight | 548.63 g/mol |
| Exact Mass | 548.24 |
| IUPAC Name | [(2S,3R,4S,5R,6R)-6-acetyloxy-4,5-dibenzyl-4,5-dihydroxy-2-(1-hydroxy-2-phenylethyl)oxan-3-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@H]1[C@@H](C(O)Cc2ccccc2)O[C@H](OC(C)=O)[C@@](O)(Cc2ccccc2)[C@]1(O)Cc1ccccc1 |
| InChI | InChI=1S/C32H36O8/c1-22(33)38-21-27-29(28(35)18-24-12-6-3-7-13-24)40-30(39-23(2)34)32(37,20-26-16-10-5-11-17-26)31(27,36)19-25-14-8-4-9-15-25/h3-17,27-30,35-37H,18-21H2,1-2H3/t27-,28?,29+,30+,31+,32+/m1/s1 |
| InChIKey | IMBIVSTVBMEMQX-HHYBHIRXSA-N |
| XLogP | 3.00 |
| TPSA | 122.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.63 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |