C32H42O13 — CID 67929786
phenylmethoxymethylbenzene;[(2R,3R,4S,5S,6S)-3,4,5-triacetyloxy-6-[1-hydroxy-2-(2-hydroxyethoxy)ethyl]oxan-2-yl]methyl acetate (PubChem CID 67929786) has the molecular formula C32H42O13 and a molecular weight of 634.68 g/mol. Its IUPAC name is phenylmethoxymethylbenzene;[(2R,3R,4S,5S,6S)-3,4,5-triacetyloxy-6-[1-hydroxy-2-(2-hydroxyethoxy)ethyl]oxan-2-yl]methyl acetate.
| Compound Name | phenylmethoxymethylbenzene;[(2R,3R,4S,5S,6S)-3,4,5-triacetyloxy-6-[1-hydroxy-2-(2-hydroxyethoxy)ethyl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 67929786 |
| Molecular Formula | C32H42O13 |
| Molecular Weight | 634.68 g/mol |
| Exact Mass | 634.26 |
| IUPAC Name | phenylmethoxymethylbenzene;[(2R,3R,4S,5S,6S)-3,4,5-triacetyloxy-6-[1-hydroxy-2-(2-hydroxyethoxy)ethyl]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](C(O)COCCO)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O.c1ccc(COCc2ccccc2)cc1 |
| InChI | InChI=1S/C18H28O12.C14H14O/c1-9(20)26-8-14-16(27-10(2)21)18(29-12(4)23)17(28-11(3)22)15(30-14)13(24)7-25-6-5-19;1-3-7-13(8-4-1)11-15-12-14-9-5-2-6-10-14/h13-19,24H,5-8H2,1-4H3;1-10H,11-12H2/t13?,14-,15+,16-,17+,18+;/m1./s1 |
| InChIKey | ICHUAHCAOQWTCS-DPXACKFASA-N |
| XLogP | 1.89 |
| TPSA | 173.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.68 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|