C30H45NO14 — CID 155433702
[(2R,3R,4R,5R,6R)-3,4-diacetyloxy-5-(2-amino-2-oxoethyl)-6-[2-[2-[2-(2-hydroxy-3-phenylmethoxypropoxy)ethoxy]ethoxy]ethoxy]oxan-2-yl]methyl acetate (PubChem CID 155433702) has the molecular formula C30H45NO14 and a molecular weight of 643.68 g/mol. Its IUPAC name is [(2R,3R,4R,5R,6R)-3,4-diacetyloxy-5-(2-amino-2-oxoethyl)-6-[2-[2-[2-(2-hydroxy-3-phenylmethoxypropoxy)ethoxy]ethoxy]ethoxy]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5R,6R)-3,4-diacetyloxy-5-(2-amino-2-oxoethyl)-6-[2-[2-[2-(2-hydroxy-3-phenylmethoxypropoxy)ethoxy]ethoxy]ethoxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 155433702 |
| Molecular Formula | C30H45NO14 |
| Molecular Weight | 643.68 g/mol |
| Exact Mass | 643.28 |
| IUPAC Name | [(2R,3R,4R,5R,6R)-3,4-diacetyloxy-5-(2-amino-2-oxoethyl)-6-[2-[2-[2-(2-hydroxy-3-phenylmethoxypropoxy)ethoxy]ethoxy]ethoxy]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](OCCOCCOCCOCC(O)COCc2ccccc2)[C@H](CC(N)=O)[C@@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C30H45NO14/c1-20(32)42-19-26-29(44-22(3)34)28(43-21(2)33)25(15-27(31)36)30(45-26)41-14-13-38-10-9-37-11-12-39-17-24(35)18-40-16-23-7-5-4-6-8-23/h4-8,24-26,28-30,35H,9-19H2,1-3H3,(H2,31,36)/t24?,25-,26-,28-,29+,30-/m1/s1 |
| InChIKey | FCMBJQHHQRRXNJ-CAALVEDNSA-N |
| XLogP | 0.27 |
| TPSA | 197.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.68 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|