C25H31NO6 — CID 57186427
N-[(2S,3S,4R,5R,6R)-4,5-dihydroxy-6-(1-hydroxy-2-phenylethyl)-2-phenylmethoxy-4-prop-2-enyloxan-3-yl]acetamide (PubChem CID 57186427) has the molecular formula C25H31NO6 and a molecular weight of 441.52 g/mol. Its IUPAC name is N-[(2S,3S,4R,5R,6R)-4,5-dihydroxy-6-(1-hydroxy-2-phenylethyl)-2-phenylmethoxy-4-prop-2-enyloxan-3-yl]acetamide.
| Compound Name | N-[(2S,3S,4R,5R,6R)-4,5-dihydroxy-6-(1-hydroxy-2-phenylethyl)-2-phenylmethoxy-4-prop-2-enyloxan-3-yl]acetamide |
|---|---|
| PubChem CID | 57186427 |
| Molecular Formula | C25H31NO6 |
| Molecular Weight | 441.52 g/mol |
| Exact Mass | 441.22 |
| IUPAC Name | N-[(2S,3S,4R,5R,6R)-4,5-dihydroxy-6-(1-hydroxy-2-phenylethyl)-2-phenylmethoxy-4-prop-2-enyloxan-3-yl]acetamide |
| SMILES | C=CC[C@]1(O)[C@H](O)[C@@H](C(O)Cc2ccccc2)O[C@H](OCc2ccccc2)[C@H]1NC(C)=O |
| InChI | InChI=1S/C25H31NO6/c1-3-14-25(30)22(26-17(2)27)24(31-16-19-12-8-5-9-13-19)32-21(23(25)29)20(28)15-18-10-6-4-7-11-18/h3-13,20-24,28-30H,1,14-16H2,2H3,(H,26,27)/t20?,21-,22-,23-,24+,25-/m1/s1 |
| InChIKey | ZKCMRGATQNWPDZ-UEMMRPAESA-N |
| XLogP | 1.70 |
| TPSA | 108.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.52 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|