C32H37NO6 — CID 66878408
N-[(2S,3S,4R,5R,6R)-5-benzyl-4,5-dihydroxy-6-(1-hydroxy-2-phenylethyl)-2-phenylmethoxy-4-prop-2-enyloxan-3-yl]acetamide (PubChem CID 66878408) has the molecular formula C32H37NO6 and a molecular weight of 531.65 g/mol. Its IUPAC name is N-[(2S,3S,4R,5R,6R)-5-benzyl-4,5-dihydroxy-6-(1-hydroxy-2-phenylethyl)-2-phenylmethoxy-4-prop-2-enyloxan-3-yl]acetamide.
| Compound Name | N-[(2S,3S,4R,5R,6R)-5-benzyl-4,5-dihydroxy-6-(1-hydroxy-2-phenylethyl)-2-phenylmethoxy-4-prop-2-enyloxan-3-yl]acetamide |
|---|---|
| PubChem CID | 66878408 |
| Molecular Formula | C32H37NO6 |
| Molecular Weight | 531.65 g/mol |
| Exact Mass | 531.26 |
| IUPAC Name | N-[(2S,3S,4R,5R,6R)-5-benzyl-4,5-dihydroxy-6-(1-hydroxy-2-phenylethyl)-2-phenylmethoxy-4-prop-2-enyloxan-3-yl]acetamide |
| SMILES | C=CC[C@@]1(O)[C@H](NC(C)=O)[C@@H](OCc2ccccc2)O[C@H](C(O)Cc2ccccc2)[C@]1(O)Cc1ccccc1 |
| InChI | InChI=1S/C32H37NO6/c1-3-19-31(36)28(33-23(2)34)30(38-22-26-17-11-6-12-18-26)39-29(27(35)20-24-13-7-4-8-14-24)32(31,37)21-25-15-9-5-10-16-25/h3-18,27-30,35-37H,1,19-22H2,2H3,(H,33,34)/t27?,28-,29-,30+,31-,32-/m1/s1 |
| InChIKey | CEZREDSDHXDAQI-UTGUTDEPSA-N |
| XLogP | 3.32 |
| TPSA | 108.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.65 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|