C21H29NO8 — CID 53309739
(2R,4S,5R,6R)-5-acetamido-6-[(1R,2R)-1,2-dihydroxy-3-phenylmethoxypropyl]-4-hydroxy-2-prop-2-enyloxane-2-carboxylic acid (PubChem CID 53309739) has the molecular formula C21H29NO8 and a molecular weight of 423.46 g/mol. Its IUPAC name is (2R,4S,5R,6R)-5-acetamido-6-[(1R,2R)-1,2-dihydroxy-3-phenylmethoxypropyl]-4-hydroxy-2-prop-2-enyloxane-2-carboxylic acid.
| Compound Name | (2R,4S,5R,6R)-5-acetamido-6-[(1R,2R)-1,2-dihydroxy-3-phenylmethoxypropyl]-4-hydroxy-2-prop-2-enyloxane-2-carboxylic acid |
|---|---|
| PubChem CID | 53309739 |
| Molecular Formula | C21H29NO8 |
| Molecular Weight | 423.46 g/mol |
| Exact Mass | 423.19 |
| IUPAC Name | (2R,4S,5R,6R)-5-acetamido-6-[(1R,2R)-1,2-dihydroxy-3-phenylmethoxypropyl]-4-hydroxy-2-prop-2-enyloxane-2-carboxylic acid |
| SMILES | C=CC[C@]1(C(=O)O)C[C@H](O)[C@@H](NC(C)=O)[C@H]([C@H](O)[C@H](O)COCc2ccccc2)O1 |
| InChI | InChI=1S/C21H29NO8/c1-3-9-21(20(27)28)10-15(24)17(22-13(2)23)19(30-21)18(26)16(25)12-29-11-14-7-5-4-6-8-14/h3-8,15-19,24-26H,1,9-12H2,2H3,(H,22,23)(H,27,28)/t15-,16+,17+,18+,19+,21+/m0/s1 |
| InChIKey | DHDUAOOSWWESTE-YKFXCJJJSA-N |
| XLogP | -0.02 |
| TPSA | 145.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.46 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|