C17H19FO7 — CID 90246566
[(3S,4R,5R)-2-acetyloxy-5-(acetyloxymethyl)-4-fluoro-3-methyloxolan-3-yl] benzoate (PubChem CID 90246566) has the molecular formula C17H19FO7 and a molecular weight of 354.33 g/mol. Its IUPAC name is [(3S,4R,5R)-2-acetyloxy-5-(acetyloxymethyl)-4-fluoro-3-methyloxolan-3-yl] benzoate.
| Compound Name | [(3S,4R,5R)-2-acetyloxy-5-(acetyloxymethyl)-4-fluoro-3-methyloxolan-3-yl] benzoate |
|---|---|
| PubChem CID | 90246566 |
| Molecular Formula | C17H19FO7 |
| Molecular Weight | 354.33 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | [(3S,4R,5R)-2-acetyloxy-5-(acetyloxymethyl)-4-fluoro-3-methyloxolan-3-yl] benzoate |
| SMILES | CC(=O)OC[C@H]1OC(OC(C)=O)[C@](C)(OC(=O)c2ccccc2)[C@@H]1F |
| InChI | InChI=1S/C17H19FO7/c1-10(19)22-9-13-14(18)17(3,16(24-13)23-11(2)20)25-15(21)12-7-5-4-6-8-12/h4-8,13-14,16H,9H2,1-3H3/t13-,14-,16?,17-/m1/s1 |
| InChIKey | COJJMMCQDIXEJG-DQZYOXILSA-N |
| XLogP | 1.79 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.33 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|