C28H31NO10 — CID 67617458
9H-fluoren-9-ylmethyl N-[(2R,3R,4R,5S,6S)-3,5-diacetyl-3,4-dihydroxy-2-(1-hydroxy-2-oxopropyl)-6-methoxyoxan-4-yl]carbamate (PubChem CID 67617458) has the molecular formula C28H31NO10 and a molecular weight of 541.55 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[(2R,3R,4R,5S,6S)-3,5-diacetyl-3,4-dihydroxy-2-(1-hydroxy-2-oxopropyl)-6-methoxyoxan-4-yl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[(2R,3R,4R,5S,6S)-3,5-diacetyl-3,4-dihydroxy-2-(1-hydroxy-2-oxopropyl)-6-methoxyoxan-4-yl]carbamate |
|---|---|
| PubChem CID | 67617458 |
| Molecular Formula | C28H31NO10 |
| Molecular Weight | 541.55 g/mol |
| Exact Mass | 541.19 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[(2R,3R,4R,5S,6S)-3,5-diacetyl-3,4-dihydroxy-2-(1-hydroxy-2-oxopropyl)-6-methoxyoxan-4-yl]carbamate |
| SMILES | CO[C@H]1O[C@H](C(O)C(C)=O)[C@](O)(C(C)=O)[C@@](O)(NC(=O)OCC2c3ccccc3-c3ccccc32)[C@@H]1C(C)=O |
| InChI | InChI=1S/C28H31NO10/c1-14(30)22-25(37-4)39-24(23(33)15(2)31)27(35,16(3)32)28(22,36)29-26(34)38-13-21-19-11-7-5-9-17(19)18-10-6-8-12-20(18)21/h5-12,21-25,33,35-36H,13H2,1-4H3,(H,29,34)/t22-,23?,24-,25+,27-,28-/m1/s1 |
| InChIKey | AWEUMOAIAOQPCE-NUXGMYAWSA-N |
| XLogP | 1.06 |
| TPSA | 168.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.55 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|