C34H30N6O5S — CID 101423298
[(2R,3R,4R,5R)-5-azido-2-(azidomethyl)-4-phenylmethoxy-6-phenylsulfanyloxan-3-yl] 9H-fluoren-9-ylmethyl carbonate (PubChem CID 101423298) has the molecular formula C34H30N6O5S and a molecular weight of 634.72 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-5-azido-2-(azidomethyl)-4-phenylmethoxy-6-phenylsulfanyloxan-3-yl] 9H-fluoren-9-ylmethyl carbonate.
| Compound Name | [(2R,3R,4R,5R)-5-azido-2-(azidomethyl)-4-phenylmethoxy-6-phenylsulfanyloxan-3-yl] 9H-fluoren-9-ylmethyl carbonate |
|---|---|
| PubChem CID | 101423298 |
| Molecular Formula | C34H30N6O5S |
| Molecular Weight | 634.72 g/mol |
| Exact Mass | 634.20 |
| IUPAC Name | [(2R,3R,4R,5R)-5-azido-2-(azidomethyl)-4-phenylmethoxy-6-phenylsulfanyloxan-3-yl] 9H-fluoren-9-ylmethyl carbonate |
| SMILES | [N-]=[N+]=NC[C@H]1OC(Sc2ccccc2)[C@H](N=[N+]=[N-])[C@@H](OCc2ccccc2)[C@@H]1OC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C34H30N6O5S/c35-39-37-19-29-31(45-34(41)43-21-28-26-17-9-7-15-24(26)25-16-8-10-18-27(25)28)32(42-20-22-11-3-1-4-12-22)30(38-40-36)33(44-29)46-23-13-5-2-6-14-23/h1-18,28-33H,19-21H2/t29-,30-,31-,32-,33?/m1/s1 |
| InChIKey | HOBMZRQFOLBDAO-SVBJYHHJSA-N |
| XLogP | 8.41 |
| TPSA | 151.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.72 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|