C20H26N4O9 — CID 90968853
benzyl N-[2-[(2S,3R,4R,5R,6R)-4,5-diacetyl-3-azido-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethyl]carbamate (PubChem CID 90968853) has the molecular formula C20H26N4O9 and a molecular weight of 466.45 g/mol. Its IUPAC name is benzyl N-[2-[(2S,3R,4R,5R,6R)-4,5-diacetyl-3-azido-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethyl]carbamate.
| Compound Name | benzyl N-[2-[(2S,3R,4R,5R,6R)-4,5-diacetyl-3-azido-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethyl]carbamate |
|---|---|
| PubChem CID | 90968853 |
| Molecular Formula | C20H26N4O9 |
| Molecular Weight | 466.45 g/mol |
| Exact Mass | 466.17 |
| IUPAC Name | benzyl N-[2-[(2S,3R,4R,5R,6R)-4,5-diacetyl-3-azido-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethyl]carbamate |
| SMILES | CC(=O)[C@@]1(O)[C@@H](CO)O[C@H](OCCNC(=O)OCc2ccccc2)[C@H](N=[N+]=[N-])[C@]1(O)C(C)=O |
| InChI | InChI=1S/C20H26N4O9/c1-12(26)19(29)15(10-25)33-17(16(23-24-21)20(19,30)13(2)27)31-9-8-22-18(28)32-11-14-6-4-3-5-7-14/h3-7,15-17,25,29-30H,8-11H2,1-2H3,(H,22,28)/t15-,16+,17+,19-,20-/m1/s1 |
| InChIKey | DAGHBBBPAIIVCL-HDHSKVTNSA-N |
| XLogP | -0.03 |
| TPSA | 200.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.45 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|