C34H40N4O7S — CID 162407514
benzyl N-[3-[3-[[(2R,4aR,6S,7R,8R,8aS)-7-azido-2-phenyl-8-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]oxy]propylsulfanyl]propyl]carbamate (PubChem CID 162407514) has the molecular formula C34H40N4O7S and a molecular weight of 648.78 g/mol. Its IUPAC name is benzyl N-[3-[3-[[(2R,4aR,6S,7R,8R,8aS)-7-azido-2-phenyl-8-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]oxy]propylsulfanyl]propyl]carbamate.
| Compound Name | benzyl N-[3-[3-[[(2R,4aR,6S,7R,8R,8aS)-7-azido-2-phenyl-8-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]oxy]propylsulfanyl]propyl]carbamate |
|---|---|
| PubChem CID | 162407514 |
| Molecular Formula | C34H40N4O7S |
| Molecular Weight | 648.78 g/mol |
| Exact Mass | 648.26 |
| IUPAC Name | benzyl N-[3-[3-[[(2R,4aR,6S,7R,8R,8aS)-7-azido-2-phenyl-8-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]oxy]propylsulfanyl]propyl]carbamate |
| SMILES | [N-]=[N+]=N[C@H]1[C@@H](OCCCSCCCNC(=O)OCc2ccccc2)O[C@@H]2CO[C@@H](c3ccccc3)O[C@H]2[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C34H40N4O7S/c35-38-37-29-31(41-22-25-12-4-1-5-13-25)30-28(24-42-32(45-30)27-16-8-3-9-17-27)44-33(29)40-19-11-21-46-20-10-18-36-34(39)43-23-26-14-6-2-7-15-26/h1-9,12-17,28-33H,10-11,18-24H2,(H,36,39)/t28-,29-,30-,31-,32-,33+/m1/s1 |
| InChIKey | JLNKTHJCGXLBCG-CPTJLBBFSA-N |
| XLogP | 6.55 |
| TPSA | 133.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.78 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|