C20H20N4O7 — CID 177404156
[(4aR,6S,7R,8R,8aS)-7-azido-2-phenyl-8-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl] nitrate (PubChem CID 177404156) has the molecular formula C20H20N4O7 and a molecular weight of 428.40 g/mol. Its IUPAC name is [(4aR,6S,7R,8R,8aS)-7-azido-2-phenyl-8-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl] nitrate.
| Compound Name | [(4aR,6S,7R,8R,8aS)-7-azido-2-phenyl-8-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl] nitrate |
|---|---|
| PubChem CID | 177404156 |
| Molecular Formula | C20H20N4O7 |
| Molecular Weight | 428.40 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | [(4aR,6S,7R,8R,8aS)-7-azido-2-phenyl-8-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl] nitrate |
| SMILES | [N-]=[N+]=N[C@H]1[C@H](O[N+](=O)[O-])O[C@@H]2COC(c3ccccc3)O[C@H]2[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C20H20N4O7/c21-23-22-16-18(27-11-13-7-3-1-4-8-13)17-15(29-20(16)31-24(25)26)12-28-19(30-17)14-9-5-2-6-10-14/h1-10,15-20H,11-12H2/t15-,16-,17-,18-,19?,20+/m1/s1 |
| InChIKey | UPFVRROPWCSDPW-NPKOBNKKSA-N |
| XLogP | 3.30 |
| TPSA | 138.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.40 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|