C38H43NO9 — CID 102456608
benzyl N-[2-[(2R,3R,4S,5R,6R)-5-hydroxy-6-[(4-methoxyphenyl)methoxymethyl]-3,4-bis(phenylmethoxy)oxan-2-yl]oxyethyl]carbamate (PubChem CID 102456608) has the molecular formula C38H43NO9 and a molecular weight of 657.76 g/mol. Its IUPAC name is benzyl N-[2-[(2R,3R,4S,5R,6R)-5-hydroxy-6-[(4-methoxyphenyl)methoxymethyl]-3,4-bis(phenylmethoxy)oxan-2-yl]oxyethyl]carbamate.
| Compound Name | benzyl N-[2-[(2R,3R,4S,5R,6R)-5-hydroxy-6-[(4-methoxyphenyl)methoxymethyl]-3,4-bis(phenylmethoxy)oxan-2-yl]oxyethyl]carbamate |
|---|---|
| PubChem CID | 102456608 |
| Molecular Formula | C38H43NO9 |
| Molecular Weight | 657.76 g/mol |
| Exact Mass | 657.29 |
| IUPAC Name | benzyl N-[2-[(2R,3R,4S,5R,6R)-5-hydroxy-6-[(4-methoxyphenyl)methoxymethyl]-3,4-bis(phenylmethoxy)oxan-2-yl]oxyethyl]carbamate |
| SMILES | COc1ccc(COC[C@H]2O[C@@H](OCCNC(=O)OCc3ccccc3)[C@H](OCc3ccccc3)[C@@H](OCc3ccccc3)[C@@H]2O)cc1 |
| InChI | InChI=1S/C38H43NO9/c1-42-32-19-17-31(18-20-32)23-43-27-33-34(40)35(45-24-28-11-5-2-6-12-28)36(46-25-29-13-7-3-8-14-29)37(48-33)44-22-21-39-38(41)47-26-30-15-9-4-10-16-30/h2-20,33-37,40H,21-27H2,1H3,(H,39,41)/t33-,34-,35+,36-,37-/m1/s1 |
| InChIKey | SETSGCVCZRALQK-KHKVHWIZSA-N |
| XLogP | 5.41 |
| TPSA | 113.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.76 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|