C16H30O6S — CID 89141818
(2R,3R,4aS,5S,7S,8R,8aR)-8-butoxy-2,3-dimethoxy-2,3,5-trimethyl-5,7,8,8a-tetrahydro-4aH-pyrano[3,4-b][1,4]dioxine-7-thiol (PubChem CID 89141818) has the molecular formula C16H30O6S and a molecular weight of 350.48 g/mol. Its IUPAC name is (2R,3R,4aS,5S,7S,8R,8aR)-8-butoxy-2,3-dimethoxy-2,3,5-trimethyl-5,7,8,8a-tetrahydro-4aH-pyrano[3,4-b][1,4]dioxine-7-thiol.
| Compound Name | (2R,3R,4aS,5S,7S,8R,8aR)-8-butoxy-2,3-dimethoxy-2,3,5-trimethyl-5,7,8,8a-tetrahydro-4aH-pyrano[3,4-b][1,4]dioxine-7-thiol |
|---|---|
| PubChem CID | 89141818 |
| Molecular Formula | C16H30O6S |
| Molecular Weight | 350.48 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | (2R,3R,4aS,5S,7S,8R,8aR)-8-butoxy-2,3-dimethoxy-2,3,5-trimethyl-5,7,8,8a-tetrahydro-4aH-pyrano[3,4-b][1,4]dioxine-7-thiol |
| SMILES | CCCCO[C@@H]1[C@@H]2O[C@@](C)(OC)[C@](C)(OC)O[C@H]2[C@H](C)O[C@H]1S |
| InChI | InChI=1S/C16H30O6S/c1-7-8-9-19-13-12-11(10(2)20-14(13)23)21-15(3,17-5)16(4,18-6)22-12/h10-14,23H,7-9H2,1-6H3/t10-,11-,12+,13+,14-,15+,16+/m0/s1 |
| InChIKey | HSBWZTVCDZUWSX-OBKMEXPCSA-N |
| XLogP | 2.36 |
| TPSA | 55.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.48 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|