C7H11Cl3O11S3 — CID 23261854
(2R,3S,4R,5R,6S)-3,4,5-tris(chlorosulfonyloxy)-2-methoxy-6-methyloxane (PubChem CID 23261854) has the molecular formula C7H11Cl3O11S3 and a molecular weight of 473.71 g/mol. Its IUPAC name is (2R,3S,4R,5R,6S)-3,4,5-tris(chlorosulfonyloxy)-2-methoxy-6-methyloxane.
| Compound Name | (2R,3S,4R,5R,6S)-3,4,5-tris(chlorosulfonyloxy)-2-methoxy-6-methyloxane |
|---|---|
| PubChem CID | 23261854 |
| Molecular Formula | C7H11Cl3O11S3 |
| Molecular Weight | 473.71 g/mol |
| Exact Mass | 471.85 |
| IUPAC Name | (2R,3S,4R,5R,6S)-3,4,5-tris(chlorosulfonyloxy)-2-methoxy-6-methyloxane |
| SMILES | CO[C@@H]1O[C@@H](C)[C@@H](OS(=O)(=O)Cl)[C@@H](OS(=O)(=O)Cl)[C@@H]1OS(=O)(=O)Cl |
| InChI | InChI=1S/C7H11Cl3O11S3/c1-3-4(19-22(8,11)12)5(20-23(9,13)14)6(7(17-2)18-3)21-24(10,15)16/h3-7H,1-2H3/t3-,4+,5+,6-,7+/m0/s1 |
| InChIKey | KTBFQVWYOAYONB-CXNFULCWSA-N |
| XLogP | -0.02 |
| TPSA | 148.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.71 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |