C7H16ClNO5S2 — CID 54599532
[4-amino-2-methoxy-5-(sulfanylmethyl)oxolan-3-yl] methanesulfonate;hydrochloride (PubChem CID 54599532) has the molecular formula C7H16ClNO5S2 and a molecular weight of 293.79 g/mol. Its IUPAC name is [4-amino-2-methoxy-5-(sulfanylmethyl)oxolan-3-yl] methanesulfonate;hydrochloride.
| Compound Name | [4-amino-2-methoxy-5-(sulfanylmethyl)oxolan-3-yl] methanesulfonate;hydrochloride |
|---|---|
| PubChem CID | 54599532 |
| Molecular Formula | C7H16ClNO5S2 |
| Molecular Weight | 293.79 g/mol |
| Exact Mass | 293.02 |
| IUPAC Name | [4-amino-2-methoxy-5-(sulfanylmethyl)oxolan-3-yl] methanesulfonate;hydrochloride |
| SMILES | COC1OC(CS)C(N)C1OS(C)(=O)=O.Cl |
| InChI | InChI=1S/C7H15NO5S2.ClH/c1-11-7-6(13-15(2,9)10)5(8)4(3-14)12-7;/h4-7,14H,3,8H2,1-2H3;1H |
| InChIKey | GOWRITPUMIVZKK-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 87.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.79 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|